C22H26ClN3O4S — CID 22710704
tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonyl-2-(2-cyanoethyl)piperazine-1-carboxylate (PubChem CID 22710704) has the molecular formula C22H26ClN3O4S and a molecular weight of 463.99 g/mol. Its IUPAC name is tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonyl-2-(2-cyanoethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonyl-2-(2-cyanoethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22710704 |
| Molecular Formula | C22H26ClN3O4S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | tert-butyl 4-(6-chloronaphthalen-2-yl)sulfonyl-2-(2-cyanoethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccc3cc(Cl)ccc3c2)CC1CCC#N |
| InChI | InChI=1S/C22H26ClN3O4S/c1-22(2,3)30-21(27)26-12-11-25(15-19(26)5-4-10-24)31(28,29)20-9-7-16-13-18(23)8-6-17(16)14-20/h6-9,13-14,19H,4-5,11-12,15H2,1-3H3 |
| InChIKey | WIBDDKJHBFKNPT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 90.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |