About CID 22717337
CID 22717337 (PubChem CID 22717337) has the molecular formula C9H20ClO2Si
and a molecular weight of 223.80 g/mol.
Molecular Properties
| Compound Name | CID 22717337 |
| PubChem CID | 22717337 |
| Molecular Formula | C9H20ClO2Si |
| Molecular Weight | 223.80 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)C(Cl)CC(C)C |
| InChI | InChI=1S/C9H20ClO2Si/c1-5-11-13(12-6-2)9(10)7-8(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | JJPRKZGEXWSQHO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22717337 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22717337?
The IUPAC name of CID 22717337 (CID 22717337) is not available.
What is the SMILES notation for CID 22717337?
The canonical SMILES for CID 22717337 is CCO[Si](OCC)C(Cl)CC(C)C.
What is the InChIKey of CID 22717337?
The InChIKey is JJPRKZGEXWSQHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20ClO2Si/c1-5-11-13(12-6-2)9(10)7-8(3)4/h8-9H,5-7H2,1-4H3.
What are the key properties of CID 22717337?
CID 22717337 has a molecular weight of 223.80 g/mol, XLogP of 2.74, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22717337 is sourced from PubChem (CID 22717337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).