C26H25O2P — CID 22717997
ethyl (2E)-2-(1,3,3-triphenylphospholan-2-ylidene)acetate (PubChem CID 22717997) has the molecular formula C26H25O2P and a molecular weight of 400.46 g/mol. Its IUPAC name is ethyl (2E)-2-(1,3,3-triphenylphospholan-2-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(1,3,3-triphenylphospholan-2-ylidene)acetate |
|---|---|
| PubChem CID | 22717997 |
| Molecular Formula | C26H25O2P |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | ethyl (2E)-2-(1,3,3-triphenylphospholan-2-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1/P(c2ccccc2)CCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25O2P/c1-2-28-25(27)20-24-26(21-12-6-3-7-13-21,22-14-8-4-9-15-22)18-19-29(24)23-16-10-5-11-17-23/h3-17,20H,2,18-19H2,1H3/b24-20+ |
| InChIKey | LBINNDMOGOQFEO-HIXSDJFHSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|