C15H17N5O2S — CID 22725397
2-[(Z)-[1-(benzenesulfonyl)-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine (PubChem CID 22725397) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 2-[(Z)-[1-(benzenesulfonyl)-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[1-(benzenesulfonyl)-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 22725397 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[(Z)-[1-(benzenesulfonyl)-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C1/CCCc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17N5O2S/c16-15(17)19-18-13-7-4-8-14-12(13)9-10-20(14)23(21,22)11-5-2-1-3-6-11/h1-3,5-6,9-10H,4,7-8H2,(H4,16,17,19)/b18-13- |
| InChIKey | MAPLWXKRPMRHOY-AQTBWJFISA-N |
| XLogP | 1.04 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|