C19H18BrN5O2S — CID 22394648
2-[(E)-[9-(benzenesulfonyl)-6-bromo-2,3-dihydro-1H-carbazol-4-ylidene]amino]guanidine (PubChem CID 22394648) has the molecular formula C19H18BrN5O2S and a molecular weight of 460.36 g/mol. Its IUPAC name is 2-[(E)-[9-(benzenesulfonyl)-6-bromo-2,3-dihydro-1H-carbazol-4-ylidene]amino]guanidine.
| Compound Name | 2-[(E)-[9-(benzenesulfonyl)-6-bromo-2,3-dihydro-1H-carbazol-4-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 22394648 |
| Molecular Formula | C19H18BrN5O2S |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 2-[(E)-[9-(benzenesulfonyl)-6-bromo-2,3-dihydro-1H-carbazol-4-ylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C1\CCCc2c1c1cc(Br)ccc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18BrN5O2S/c20-12-9-10-16-14(11-12)18-15(23-24-19(21)22)7-4-8-17(18)25(16)28(26,27)13-5-2-1-3-6-13/h1-3,5-6,9-11H,4,7-8H2,(H4,21,22,24)/b23-15+ |
| InChIKey | AUQYPYVUGXEYRH-HZHRSRAPSA-N |
| XLogP | 2.95 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|