C14H12ClNO3S — CID 13437713
1-(benzenesulfonyl)-5-chloro-6,7-dihydro-5H-indol-4-one (PubChem CID 13437713) has the molecular formula C14H12ClNO3S and a molecular weight of 309.77 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-chloro-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-(benzenesulfonyl)-5-chloro-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 13437713 |
| Molecular Formula | C14H12ClNO3S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 1-(benzenesulfonyl)-5-chloro-6,7-dihydro-5H-indol-4-one |
| SMILES | O=C1c2ccn(S(=O)(=O)c3ccccc3)c2CCC1Cl |
| InChI | InChI=1S/C14H12ClNO3S/c15-12-6-7-13-11(14(12)17)8-9-16(13)20(18,19)10-4-2-1-3-5-10/h1-5,8-9,12H,6-7H2 |
| InChIKey | KWOUMFKGULGRGR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|