C16H13NO5S — CID 15185319
1-(benzenesulfonyl)-4,5,5a,8a-tetrahydrofuro[3,4-g]indole-6,8-dione (PubChem CID 15185319) has the molecular formula C16H13NO5S and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4,5,5a,8a-tetrahydrofuro[3,4-g]indole-6,8-dione.
| Compound Name | 1-(benzenesulfonyl)-4,5,5a,8a-tetrahydrofuro[3,4-g]indole-6,8-dione |
|---|---|
| PubChem CID | 15185319 |
| Molecular Formula | C16H13NO5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-(benzenesulfonyl)-4,5,5a,8a-tetrahydrofuro[3,4-g]indole-6,8-dione |
| SMILES | O=C1OC(=O)C2c3c(ccn3S(=O)(=O)c3ccccc3)CCC12 |
| InChI | InChI=1S/C16H13NO5S/c18-15-12-7-6-10-8-9-17(14(10)13(12)16(19)22-15)23(20,21)11-4-2-1-3-5-11/h1-5,8-9,12-13H,6-7H2 |
| InChIKey | DLFNHASIWYTDBH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|