C20H16ClNO4S2 — CID 10478014
1-(benzenesulfonyl)-7-(4-chlorophenyl)sulfinyl-6,7-dihydro-5H-indol-4-one (PubChem CID 10478014) has the molecular formula C20H16ClNO4S2 and a molecular weight of 433.94 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-7-(4-chlorophenyl)sulfinyl-6,7-dihydro-5H-indol-4-one.
| Compound Name | 1-(benzenesulfonyl)-7-(4-chlorophenyl)sulfinyl-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 10478014 |
| Molecular Formula | C20H16ClNO4S2 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 1-(benzenesulfonyl)-7-(4-chlorophenyl)sulfinyl-6,7-dihydro-5H-indol-4-one |
| SMILES | O=C1CCC(S(=O)c2ccc(Cl)cc2)c2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16ClNO4S2/c21-14-6-8-15(9-7-14)27(24)19-11-10-18(23)17-12-13-22(20(17)19)28(25,26)16-4-2-1-3-5-16/h1-9,12-13,19H,10-11H2 |
| InChIKey | AQRLBEFLCZGFHX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |