C21H25NO2S — CID 102591755
(5aS,6S,9aS)-3-(benzenesulfonyl)-6-ethenyl-9a-methyl-5,5a,6,7,8,9-hexahydro-4H-benzo[e]indole (PubChem CID 102591755) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is (5aS,6S,9aS)-3-(benzenesulfonyl)-6-ethenyl-9a-methyl-5,5a,6,7,8,9-hexahydro-4H-benzo[e]indole.
| Compound Name | (5aS,6S,9aS)-3-(benzenesulfonyl)-6-ethenyl-9a-methyl-5,5a,6,7,8,9-hexahydro-4H-benzo[e]indole |
|---|---|
| PubChem CID | 102591755 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (5aS,6S,9aS)-3-(benzenesulfonyl)-6-ethenyl-9a-methyl-5,5a,6,7,8,9-hexahydro-4H-benzo[e]indole |
| SMILES | C=C[C@@H]1CCC[C@]2(C)c3ccn(S(=O)(=O)c4ccccc4)c3CC[C@@H]12 |
| InChI | InChI=1S/C21H25NO2S/c1-3-16-8-7-14-21(2)18(16)11-12-20-19(21)13-15-22(20)25(23,24)17-9-5-4-6-10-17/h3-6,9-10,13,15-16,18H,1,7-8,11-12,14H2,2H3/t16-,18+,21+/m1/s1 |
| InChIKey | INCAEJKDUMPDNA-MMOPVJDHSA-N |
| XLogP | 4.53 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|