C30H34N6O6S — CID 22732258
N-[3-[[6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-yl]amino]-4-methylphenyl]-2-morpholin-4-ylpyridine-4-carboxamide (PubChem CID 22732258) has the molecular formula C30H34N6O6S and a molecular weight of 606.71 g/mol. Its IUPAC name is N-[3-[[6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-yl]amino]-4-methylphenyl]-2-morpholin-4-ylpyridine-4-carboxamide.
| Compound Name | N-[3-[[6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-yl]amino]-4-methylphenyl]-2-morpholin-4-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 22732258 |
| Molecular Formula | C30H34N6O6S |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | N-[3-[[6-methoxy-7-(3-methylsulfonylpropoxy)quinazolin-4-yl]amino]-4-methylphenyl]-2-morpholin-4-ylpyridine-4-carboxamide |
| SMILES | COc1cc2c(Nc3cc(NC(=O)c4ccnc(N5CCOCC5)c4)ccc3C)ncnc2cc1OCCCS(C)(=O)=O |
| InChI | InChI=1S/C30H34N6O6S/c1-20-5-6-22(34-30(37)21-7-8-31-28(15-21)36-9-12-41-13-10-36)16-24(20)35-29-23-17-26(40-2)27(18-25(23)32-19-33-29)42-11-4-14-43(3,38)39/h5-8,15-19H,4,9-14H2,1-3H3,(H,34,37)(H,32,33,35) |
| InChIKey | DRQHJDIEQXZZKU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|