C21H33B2NO4 — CID 22737465
(E)-N,N-bis(prop-2-ynyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 22737465) has the molecular formula C21H33B2NO4 and a molecular weight of 385.12 g/mol. Its IUPAC name is (E)-N,N-bis(prop-2-ynyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | (E)-N,N-bis(prop-2-ynyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 22737465 |
| Molecular Formula | C21H33B2NO4 |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (E)-N,N-bis(prop-2-ynyl)-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | C#CCN(CC#C)C/C(=C/B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H33B2NO4/c1-11-13-24(14-12-2)16-17(23-27-20(7,8)21(9,10)28-23)15-22-25-18(3,4)19(5,6)26-22/h1-2,15H,13-14,16H2,3-10H3/b17-15- |
| InChIKey | WWGNALRQVNSUFI-ICFOKQHNSA-N |
| XLogP | 2.74 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|