C19H15Cl2F3N2O3 — CID 22752462
N-[[6-chloro-4-(2-chloroacetyl)-2-phenyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 22752462) has the molecular formula C19H15Cl2F3N2O3 and a molecular weight of 447.24 g/mol. Its IUPAC name is N-[[6-chloro-4-(2-chloroacetyl)-2-phenyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[6-chloro-4-(2-chloroacetyl)-2-phenyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 22752462 |
| Molecular Formula | C19H15Cl2F3N2O3 |
| Molecular Weight | 447.24 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | N-[[6-chloro-4-(2-chloroacetyl)-2-phenyl-2,3-dihydro-1,4-benzoxazin-3-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(CCl)N1c2cc(Cl)ccc2OC(c2ccccc2)C1CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C19H15Cl2F3N2O3/c20-9-16(27)26-13-8-12(21)6-7-15(13)29-17(11-4-2-1-3-5-11)14(26)10-25-18(28)19(22,23)24/h1-8,14,17H,9-10H2,(H,25,28) |
| InChIKey | RIYNLHALRRSVAI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.24 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|