C12H15F3N4O — CID 22769606
1-(diaminomethylidene)-3-[2-propyl-6-(trifluoromethyl)phenyl]urea (PubChem CID 22769606) has the molecular formula C12H15F3N4O and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[2-propyl-6-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(diaminomethylidene)-3-[2-propyl-6-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 22769606 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 1-(diaminomethylidene)-3-[2-propyl-6-(trifluoromethyl)phenyl]urea |
| SMILES | CCCc1cccc(C(F)(F)F)c1NC(=O)N=C(N)N |
| InChI | InChI=1S/C12H15F3N4O/c1-2-4-7-5-3-6-8(12(13,14)15)9(7)18-11(20)19-10(16)17/h3,5-6H,2,4H2,1H3,(H5,16,17,18,19,20) |
| InChIKey | VWFSBGOABDNNAV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|