C27H30N2O2S — CID 22782008
N-[4-[1-oxo-1-(N-phenylanilino)butan-2-yl]sulfanylphenyl]pentanamide (PubChem CID 22782008) has the molecular formula C27H30N2O2S and a molecular weight of 446.62 g/mol. Its IUPAC name is N-[4-[1-oxo-1-(N-phenylanilino)butan-2-yl]sulfanylphenyl]pentanamide.
| Compound Name | N-[4-[1-oxo-1-(N-phenylanilino)butan-2-yl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 22782008 |
| Molecular Formula | C27H30N2O2S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[4-[1-oxo-1-(N-phenylanilino)butan-2-yl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(SC(CC)C(=O)N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O2S/c1-3-5-16-26(30)28-21-17-19-24(20-18-21)32-25(4-2)27(31)29(22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,17-20,25H,3-5,16H2,1-2H3,(H,28,30) |
| InChIKey | NZMBGZVXAVFNOW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |