C25H22N2O4S — CID 22784604
(E)-4-oxo-4-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]but-2-enoic acid (PubChem CID 22784604) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is (E)-4-oxo-4-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]but-2-enoic acid |
|---|---|
| PubChem CID | 22784604 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | (E)-4-oxo-4-[4-[1-oxo-1-(N-phenylanilino)propan-2-yl]sulfanylanilino]but-2-enoic acid |
| SMILES | CC(Sc1ccc(NC(=O)/C=C/C(=O)O)cc1)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O4S/c1-18(32-22-14-12-19(13-15-22)26-23(28)16-17-24(29)30)25(31)27(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-18H,1H3,(H,26,28)(H,29,30)/b17-16+ |
| InChIKey | OFHXGSQHECMNON-WUKNDPDISA-N |
| XLogP | 5.11 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|