C24H24N2O2S — CID 19631326
2-(4-acetamidophenyl)sulfanyl-N,N-diphenylbutanamide (PubChem CID 19631326) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)sulfanyl-N,N-diphenylbutanamide.
| Compound Name | 2-(4-acetamidophenyl)sulfanyl-N,N-diphenylbutanamide |
|---|---|
| PubChem CID | 19631326 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-(4-acetamidophenyl)sulfanyl-N,N-diphenylbutanamide |
| SMILES | CCC(Sc1ccc(NC(C)=O)cc1)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2S/c1-3-23(29-22-16-14-19(15-17-22)25-18(2)27)24(28)26(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,23H,3H2,1-2H3,(H,25,27) |
| InChIKey | BRGVENXQNUATLQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |