C18H15N5O5S2 — CID 22786711
4-[3-[[5-(5-methylfuran-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 22786711) has the molecular formula C18H15N5O5S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-[3-[[5-(5-methylfuran-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[[5-(5-methylfuran-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22786711 |
| Molecular Formula | C18H15N5O5S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 4-[3-[[5-(5-methylfuran-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-2,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cnnc(SC3CC(=O)N(c4ccc(S(N)(=O)=O)cc4)C3=O)n2)o1 |
| InChI | InChI=1S/C18H15N5O5S2/c1-10-2-7-14(28-10)13-9-20-22-18(21-13)29-15-8-16(24)23(17(15)25)11-3-5-12(6-4-11)30(19,26)27/h2-7,9,15H,8H2,1H3,(H2,19,26,27) |
| InChIKey | KEOAPXXMDJKNFE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 149.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|