C28H26N4O6S2 — CID 138497256
ethyl 4-[2,5-dioxo-3-[1-[2-(4-sulfamoylphenyl)ethyl]benzimidazol-2-yl]sulfanylpyrrolidin-1-yl]benzoate (PubChem CID 138497256) has the molecular formula C28H26N4O6S2 and a molecular weight of 578.67 g/mol. Its IUPAC name is ethyl 4-[2,5-dioxo-3-[1-[2-(4-sulfamoylphenyl)ethyl]benzimidazol-2-yl]sulfanylpyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[2,5-dioxo-3-[1-[2-(4-sulfamoylphenyl)ethyl]benzimidazol-2-yl]sulfanylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 138497256 |
| Molecular Formula | C28H26N4O6S2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | ethyl 4-[2,5-dioxo-3-[1-[2-(4-sulfamoylphenyl)ethyl]benzimidazol-2-yl]sulfanylpyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(Sc3nc4ccccc4n3CCc3ccc(S(N)(=O)=O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H26N4O6S2/c1-2-38-27(35)19-9-11-20(12-10-19)32-25(33)17-24(26(32)34)39-28-30-22-5-3-4-6-23(22)31(28)16-15-18-7-13-21(14-8-18)40(29,36)37/h3-14,24H,2,15-17H2,1H3,(H2,29,36,37) |
| InChIKey | RHTTYCVDOAILPO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 141.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|