C23H26FNO — CID 22805354
(1R,9R,10R)-4-(3-fluorophenoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 22805354) has the molecular formula C23H26FNO and a molecular weight of 351.47 g/mol. Its IUPAC name is (1R,9R,10R)-4-(3-fluorophenoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10R)-4-(3-fluorophenoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 22805354 |
| Molecular Formula | C23H26FNO |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | (1R,9R,10R)-4-(3-fluorophenoxy)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(Oc2cccc(F)c2)cc13 |
| InChI | InChI=1S/C23H26FNO/c1-25-12-11-23-10-3-2-7-20(23)22(25)13-16-8-9-19(15-21(16)23)26-18-6-4-5-17(24)14-18/h4-6,8-9,14-15,20,22H,2-3,7,10-13H2,1H3/t20-,22+,23+/m0/s1 |
| InChIKey | NAICFMKORRPJNX-MDNUFGMLSA-N |
| XLogP | 5.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |