C14H24NO3+ — CID 2280971
2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl-(2-hydroxyethyl)azanium (PubChem CID 2280971) has the molecular formula C14H24NO3+ and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl-(2-hydroxyethyl)azanium.
| Compound Name | 2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 2280971 |
| Molecular Formula | C14H24NO3+ |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-[2-(2,3-dimethylphenoxy)ethoxy]ethyl-(2-hydroxyethyl)azanium |
| SMILES | Cc1cccc(OCCOCC[NH2+]CCO)c1C |
| InChI | InChI=1S/C14H23NO3/c1-12-4-3-5-14(13(12)2)18-11-10-17-9-7-15-6-8-16/h3-5,15-16H,6-11H2,1-2H3/p+1 |
| InChIKey | CADRWUYVXMNBQE-UHFFFAOYSA-O |
| XLogP | 0.25 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|