C23H37NO — CID 22811394
(1S,4aR,4bR)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide (PubChem CID 22811394) has the molecular formula C23H37NO and a molecular weight of 343.56 g/mol. Its IUPAC name is (1S,4aR,4bR)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aR,4bR)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 22811394 |
| Molecular Formula | C23H37NO |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.29 |
| IUPAC Name | (1S,4aR,4bR)-1,4a-dimethyl-7-propan-2-yl-N-prop-2-enyl-2,3,4,4b,5,6,7,8,10,10a-decahydrophenanthrene-1-carboxamide |
| SMILES | C=CCNC(=O)[C@@]1(C)CCC[C@@]2(C)C1CC=C1CC(C(C)C)CC[C@H]12 |
| InChI | InChI=1S/C23H37NO/c1-6-14-24-21(25)23(5)13-7-12-22(4)19-10-8-17(16(2)3)15-18(19)9-11-20(22)23/h6,9,16-17,19-20H,1,7-8,10-15H2,2-5H3,(H,24,25)/t17?,19-,20?,22-,23+/m1/s1 |
| InChIKey | ZQCDZIDWYHXOMQ-JVSFRWJXSA-N |
| XLogP | 5.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|