C23H27FN2O2 — CID 22815336
(4aS,8aS)-6-[4-(4-fluorophenyl)-4-oxobutyl]-2,3-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one (PubChem CID 22815336) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is (4aS,8aS)-6-[4-(4-fluorophenyl)-4-oxobutyl]-2,3-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one.
| Compound Name | (4aS,8aS)-6-[4-(4-fluorophenyl)-4-oxobutyl]-2,3-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one |
|---|---|
| PubChem CID | 22815336 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (4aS,8aS)-6-[4-(4-fluorophenyl)-4-oxobutyl]-2,3-dimethyl-4a,5,7,8,8a,9-hexahydro-1H-pyrrolo[2,3-g]isoquinolin-4-one |
| SMILES | Cc1[nH]c2c(c1C)C(=O)[C@@H]1CN(CCCC(=O)c3ccc(F)cc3)CC[C@H]1C2 |
| InChI | InChI=1S/C23H27FN2O2/c1-14-15(2)25-20-12-17-9-11-26(13-19(17)23(28)22(14)20)10-3-4-21(27)16-5-7-18(24)8-6-16/h5-8,17,19,25H,3-4,9-13H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | KPDRFXGNNOHZSM-PKOBYXMFSA-N |
| XLogP | 4.11 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |