C24H38O2 — CID 22816074
(3aR)-6-but-3-enyl-2-ethyl-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one (PubChem CID 22816074) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is (3aR)-6-but-3-enyl-2-ethyl-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one.
| Compound Name | (3aR)-6-but-3-enyl-2-ethyl-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
|---|---|
| PubChem CID | 22816074 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | (3aR)-6-but-3-enyl-2-ethyl-3a-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,4,5,8,9,9a,9b-octahydro-1H-cyclopenta[a]naphthalen-7-one |
| SMILES | C=CCCC1=C2CC[C@]3(C)C(CC(CC)C3OC(C)(C)C)C2CCC1=O |
| InChI | InChI=1S/C24H38O2/c1-7-9-10-19-17-13-14-24(6)20(18(17)11-12-21(19)25)15-16(8-2)22(24)26-23(3,4)5/h7,16,18,20,22H,1,8-15H2,2-6H3/t16?,18?,20?,22?,24-/m1/s1 |
| InChIKey | CZKBDLBGPZRQCW-BJWQEGTOSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|