C20H33Br2N3 — CID 22828629
(1R,2R)-6-ethyl-8-methyl-1-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrobromide (PubChem CID 22828629) has the molecular formula C20H33Br2N3 and a molecular weight of 475.31 g/mol. Its IUPAC name is (1R,2R)-6-ethyl-8-methyl-1-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrobromide.
| Compound Name | (1R,2R)-6-ethyl-8-methyl-1-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrobromide |
|---|---|
| PubChem CID | 22828629 |
| Molecular Formula | C20H33Br2N3 |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | (1R,2R)-6-ethyl-8-methyl-1-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene;dihydrobromide |
| SMILES | Br.Br.CCN1CCN[C@@H]2C1C(C)=CN1C3=C(CCC=C3)C[C@@]21C(C)C |
| InChI | InChI=1S/C20H31N3.2BrH/c1-5-22-11-10-21-19-18(22)15(4)13-23-17-9-7-6-8-16(17)12-20(19,23)14(2)3;;/h7,9,13-14,18-19,21H,5-6,8,10-12H2,1-4H3;2*1H/t18?,19-,20-;;/m1../s1 |
| InChIKey | SNKONMRLGODZBW-AWKKWWGPSA-N |
| XLogP | 4.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |