C15H21N3 — CID 22828642
(1S,2R)-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene (PubChem CID 22828642) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (1S,2R)-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene.
| Compound Name | (1S,2R)-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
|---|---|
| PubChem CID | 22828642 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (1S,2R)-8-methyl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
| SMILES | CC1=CN2C3=C(CCC=C3)C[C@H]2[C@@H]2NCCNC12 |
| InChI | InChI=1S/C15H21N3/c1-10-9-18-12-5-3-2-4-11(12)8-13(18)15-14(10)16-6-7-17-15/h3,5,9,13-17H,2,4,6-8H2,1H3/t13-,14?,15-/m0/s1 |
| InChIKey | ACPFGNJNDPYHMT-LWEDLAQUSA-N |
| XLogP | 1.51 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |