C19H30BrN3 — CID 18597961
(1R)-3,6-diethyl-8-methyl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide (PubChem CID 18597961) has the molecular formula C19H30BrN3 and a molecular weight of 380.37 g/mol. Its IUPAC name is (1R)-3,6-diethyl-8-methyl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide.
| Compound Name | (1R)-3,6-diethyl-8-methyl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide |
|---|---|
| PubChem CID | 18597961 |
| Molecular Formula | C19H30BrN3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | (1R)-3,6-diethyl-8-methyl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide |
| SMILES | CCN1CCN(CC)C2C1C(C)=C[NH+]1C3=C(CCC=C3)C[C@H]21.[Br-] |
| InChI | InChI=1S/C19H29N3.BrH/c1-4-20-10-11-21(5-2)19-17-12-15-8-6-7-9-16(15)22(17)13-14(3)18(19)20;/h7,9,13,17-19H,4-6,8,10-12H2,1-3H3;1H/t17-,18?,19?;/m1./s1 |
| InChIKey | ZFXZVTFQVFRQAH-SZFIPDBASA-N |
| XLogP | -1.44 |
| TPSA | 10.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |