C84H62N8O10Zn — CID 22835058
CID 22835058 (PubChem CID 22835058) has the molecular formula C84H62N8O10Zn and a molecular weight of 1408.86 g/mol.
| Compound Name | CID 22835058 |
|---|---|
| PubChem CID | 22835058 |
| Molecular Formula | C84H62N8O10Zn |
| Molecular Weight | 1408.86 g/mol |
| Exact Mass | 1406.39 |
| IUPAC Name | — |
| SMILES | O=C1N2Cc3cc4c5cc3CN3C(=O)N6Cc7cc8c(cc7CN1C6(c1ccccc1)C23c1ccccc1)OCCOc1ccccc1-c1c2nc(c(c3ccc([n-]3)c(c3nc(c(c6ccc1[n-]6)-c1ccccc1OCCO5)C=C3)-c1ccccc1OCCO4)-c1ccccc1OCCO8)C=C2.[Zn+2] |
| InChI | InChI=1S/C84H62N8O10.Zn/c93-81-89-47-51-43-73-74-44-52(51)48-90-82(94)92-50-53-45-75-76(46-54(53)49-91(81)84(92,56-17-5-2-6-18-56)83(89,90)55-15-3-1-4-16-55)102-42-38-98-72-26-14-10-22-60(72)80-64-30-29-63(86-64)79(59-21-9-13-25-71(59)97-37-41-101-75)67-33-31-65(87-67)77(57-19-7-11-23-69(57)95-35-39-99-73)61-27-28-62(85-61)78(66-32-34-68(80)88-66)58-20-8-12-24-70(58)96-36-40-100-74;/h1-34,43-46H,35-42,47-50H2;/q-2;+2/b77-61-,77-65-,78-62+,78-66-,79-63+,79-67-,80-64-,80-68-; |
| InChIKey | KCDLDRLPKAQSHX-NODHQDQVSA-N |
| XLogP | 15.26 |
| TPSA | 174.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 103 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1408.86 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|