C70H80N4O7 — CID 174247373
5,15-bis(4-butoxyphenyl)-10,20-bis(3,4-dibutoxyphenyl)-23-methylporphyrin-21-carbaldehyde (PubChem CID 174247373) has the molecular formula C70H80N4O7 and a molecular weight of 1089.43 g/mol. Its IUPAC name is 5,15-bis(4-butoxyphenyl)-10,20-bis(3,4-dibutoxyphenyl)-23-methylporphyrin-21-carbaldehyde.
| Compound Name | 5,15-bis(4-butoxyphenyl)-10,20-bis(3,4-dibutoxyphenyl)-23-methylporphyrin-21-carbaldehyde |
|---|---|
| PubChem CID | 174247373 |
| Molecular Formula | C70H80N4O7 |
| Molecular Weight | 1089.43 g/mol |
| Exact Mass | 1088.60 |
| IUPAC Name | 5,15-bis(4-butoxyphenyl)-10,20-bis(3,4-dibutoxyphenyl)-23-methylporphyrin-21-carbaldehyde |
| SMILES | CCCCOc1ccc(-c2c3nc(c(-c4ccc(OCCCC)c(OCCCC)c4)c4ccc(c(-c5ccc(OCCCC)cc5)c5nc(c(-c6ccc(OCCCC)c(OCCCC)c6)c6ccc2n6C)C=C5)n4C=O)C=C3)cc1 |
| InChI | InChI=1S/C70H80N4O7/c1-8-14-40-76-53-26-20-49(21-27-53)67-55-30-33-58(71-55)70(52-25-39-64(79-43-17-11-4)66(47-52)81-45-19-13-6)62-37-36-61(74(62)48-75)68(50-22-28-54(29-23-50)77-41-15-9-2)56-31-32-57(72-56)69(60-35-34-59(67)73(60)7)51-24-38-63(78-42-16-10-3)65(46-51)80-44-18-12-5/h20-39,46-48H,8-19,40-45H2,1-7H3/b67-55-,67-59-,68-56-,68-61-,69-57-,69-60-,70-58-,70-62- |
| InChIKey | ZGHSRYJJCZYDRY-VXSIPPGTSA-N |
| XLogP | 17.92 |
| TPSA | 108.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1089.43 |
| LogP ≤ 5 | 17.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|