C19H31N7O5 — CID 22845500
(2S)-2,6-diamino-N-[2-[[2-[[(2S)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]hexanamide (PubChem CID 22845500) has the molecular formula C19H31N7O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[[2-[[(2S)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[[2-[[(2S)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 22845500 |
| Molecular Formula | C19H31N7O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[[2-[[(2S)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCC(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NN |
| InChI | InChI=1S/C19H31N7O5/c20-8-2-1-3-14(21)18(30)24-10-16(28)23-11-17(29)25-15(19(31)26-22)9-12-4-6-13(27)7-5-12/h4-7,14-15,27H,1-3,8-11,20-22H2,(H,23,28)(H,24,30)(H,25,29)(H,26,31)/t14-,15-/m0/s1 |
| InChIKey | ITNBKAZRGYAOLB-GJZGRUSLSA-N |
| XLogP | -2.90 |
| TPSA | 214.69 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|