C23H38Cl2N4O9P2 — CID 22855877
[5-[[(2S)-1-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]pyrrolidine-2-carbonyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid (PubChem CID 22855877) has the molecular formula C23H38Cl2N4O9P2 and a molecular weight of 647.43 g/mol. Its IUPAC name is [5-[[(2S)-1-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]pyrrolidine-2-carbonyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid.
| Compound Name | [5-[[(2S)-1-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]pyrrolidine-2-carbonyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid |
|---|---|
| PubChem CID | 22855877 |
| Molecular Formula | C23H38Cl2N4O9P2 |
| Molecular Weight | 647.43 g/mol |
| Exact Mass | 646.15 |
| IUPAC Name | [5-[[(2S)-1-[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]pyrrolidine-2-carbonyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid |
| SMILES | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)N1CCC[C@H]1C(=O)NCCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C23H38Cl2N4O9P2/c24-10-14-28(15-11-25)18-7-5-17(6-8-18)16-19(26)22(31)29-13-3-4-20(29)21(30)27-12-2-1-9-23(32,39(33,34)35)40(36,37)38/h5-8,19-20,32H,1-4,9-16,26H2,(H,27,30)(H2,33,34,35)(H2,36,37,38)/t19-,20-/m0/s1 |
| InChIKey | NQNGCPRIORHJBS-PMACEKPBSA-N |
| XLogP | 1.12 |
| TPSA | 213.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|