C29H25FN4O4 — CID 22861951
(2R,3R,4S,5R)-2-(2-fluoropurin-9-yl)-5-(trityloxymethyl)oxolane-3,4-diol (PubChem CID 22861951) has the molecular formula C29H25FN4O4 and a molecular weight of 512.54 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(2-fluoropurin-9-yl)-5-(trityloxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(2-fluoropurin-9-yl)-5-(trityloxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 22861951 |
| Molecular Formula | C29H25FN4O4 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-(2-fluoropurin-9-yl)-5-(trityloxymethyl)oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@H]1n1cnc2cnc(F)nc21 |
| InChI | InChI=1S/C29H25FN4O4/c30-28-31-16-22-26(33-28)34(18-32-22)27-25(36)24(35)23(38-27)17-37-29(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-16,18,23-25,27,35-36H,17H2/t23-,24-,25-,27-/m1/s1 |
| InChIKey | QHEGPCJSSLAZOO-DLGLWYJGSA-N |
| XLogP | 3.59 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|