C22H35N4O3+ — CID 22866369
ethyl (2S)-4-methyl-2-[methyl-[6-(2-methyl-3H-imidazo[4,5-c]pyridin-5-ium-5-yl)hexanoyl]amino]pentanoate (PubChem CID 22866369) has the molecular formula C22H35N4O3+ and a molecular weight of 403.55 g/mol. Its IUPAC name is ethyl (2S)-4-methyl-2-[methyl-[6-(2-methyl-3H-imidazo[4,5-c]pyridin-5-ium-5-yl)hexanoyl]amino]pentanoate.
| Compound Name | ethyl (2S)-4-methyl-2-[methyl-[6-(2-methyl-3H-imidazo[4,5-c]pyridin-5-ium-5-yl)hexanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 22866369 |
| Molecular Formula | C22H35N4O3+ |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | ethyl (2S)-4-methyl-2-[methyl-[6-(2-methyl-3H-imidazo[4,5-c]pyridin-5-ium-5-yl)hexanoyl]amino]pentanoate |
| SMILES | CCOC(=O)[C@H](CC(C)C)N(C)C(=O)CCCCC[n+]1ccc2nc(C)[nH]c2c1 |
| InChI | InChI=1S/C22H34N4O3/c1-6-29-22(28)20(14-16(2)3)25(5)21(27)10-8-7-9-12-26-13-11-18-19(15-26)24-17(4)23-18/h11,13,15-16,20H,6-10,12,14H2,1-5H3/p+1/t20-/m0/s1 |
| InChIKey | FMKIAWPJOKZYTR-FQEVSTJZSA-O |
| XLogP | 3.16 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|