C25H32F3NO5S — CID 22882933
1-[(3S,5S)-7,8-diethoxy-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol (PubChem CID 22882933) has the molecular formula C25H32F3NO5S and a molecular weight of 515.59 g/mol. Its IUPAC name is 1-[(3S,5S)-7,8-diethoxy-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol.
| Compound Name | 1-[(3S,5S)-7,8-diethoxy-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 22882933 |
| Molecular Formula | C25H32F3NO5S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 1-[(3S,5S)-7,8-diethoxy-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-3-yl]-4,4,4-trifluorobutan-2-ol |
| SMILES | CCOc1cc2c(cc1OCC)S(=O)(=O)C[C@](CC)(CC(O)CC(F)(F)F)N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H32F3NO5S/c1-4-24(14-18(30)15-25(26,27)28)16-35(31,32)22-13-21(34-6-3)20(33-5-2)12-19(22)23(29-24)17-10-8-7-9-11-17/h7-13,18,23,29-30H,4-6,14-16H2,1-3H3/t18?,23-,24-/m0/s1 |
| InChIKey | RSVJPGXEMLNCNW-JUQRWGLSSA-N |
| XLogP | 4.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |