C20H42O10 — CID 22886701
1,2,3,4,5-pentakis(2-methoxyethoxy)pentane (PubChem CID 22886701) has the molecular formula C20H42O10 and a molecular weight of 442.55 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis(2-methoxyethoxy)pentane.
| Compound Name | 1,2,3,4,5-pentakis(2-methoxyethoxy)pentane |
|---|---|
| PubChem CID | 22886701 |
| Molecular Formula | C20H42O10 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1,2,3,4,5-pentakis(2-methoxyethoxy)pentane |
| SMILES | COCCOCC(OCCOC)C(OCCOC)C(COCCOC)OCCOC |
| InChI | InChI=1S/C20H42O10/c1-21-6-11-26-16-18(28-13-8-23-3)20(30-15-10-25-5)19(29-14-9-24-4)17-27-12-7-22-2/h18-20H,6-17H2,1-5H3 |
| InChIKey | ROSOFJIWZPWCBW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|