C13H17Br7O2 — CID 22892703
1,1,1,3,3,11,11-heptabromotridecane-2,12-dione (PubChem CID 22892703) has the molecular formula C13H17Br7O2 and a molecular weight of 764.60 g/mol. Its IUPAC name is 1,1,1,3,3,11,11-heptabromotridecane-2,12-dione.
| Compound Name | 1,1,1,3,3,11,11-heptabromotridecane-2,12-dione |
|---|---|
| PubChem CID | 22892703 |
| Molecular Formula | C13H17Br7O2 |
| Molecular Weight | 764.60 g/mol |
| Exact Mass | 757.55 |
| IUPAC Name | 1,1,1,3,3,11,11-heptabromotridecane-2,12-dione |
| SMILES | CC(=O)C(Br)(Br)CCCCCCCC(Br)(Br)C(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C13H17Br7O2/c1-9(21)11(14,15)7-5-3-2-4-6-8-12(16,17)10(22)13(18,19)20/h2-8H2,1H3 |
| InChIKey | NORRVWZEBVRXJP-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.60 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|