C28H48O7 — CID 22895711
4-(1-ethoxyethoxycarbonyl)-2,2,4,6-tetramethyl-6-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid (PubChem CID 22895711) has the molecular formula C28H48O7 and a molecular weight of 496.69 g/mol. Its IUPAC name is 4-(1-ethoxyethoxycarbonyl)-2,2,4,6-tetramethyl-6-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid.
| Compound Name | 4-(1-ethoxyethoxycarbonyl)-2,2,4,6-tetramethyl-6-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid |
|---|---|
| PubChem CID | 22895711 |
| Molecular Formula | C28H48O7 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | 4-(1-ethoxyethoxycarbonyl)-2,2,4,6-tetramethyl-6-[(4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxycarbonyl]octanoic acid |
| SMILES | CCOC(C)OC(=O)C(C)(CC(C)(C)C(=O)O)CC(C)(CC)C(=O)OC1CC2(C)CCC1C2(C)C |
| InChI | InChI=1S/C28H48O7/c1-11-26(8,22(31)35-20-15-28(10)14-13-19(20)25(28,6)7)17-27(9,16-24(4,5)21(29)30)23(32)34-18(3)33-12-2/h18-20H,11-17H2,1-10H3,(H,29,30) |
| InChIKey | FJEBDEOHJXYLOQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|