C42H41N — CID 22900167
N,N-bis(4-tert-butylphenyl)-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidenemethyl)aniline (PubChem CID 22900167) has the molecular formula C42H41N and a molecular weight of 559.80 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidenemethyl)aniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidenemethyl)aniline |
|---|---|
| PubChem CID | 22900167 |
| Molecular Formula | C42H41N |
| Molecular Weight | 559.80 g/mol |
| Exact Mass | 559.32 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidenemethyl)aniline |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C=C3c4ccccc4C=Cc4ccccc43)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C42H41N/c1-41(2,3)33-19-25-36(26-20-33)43(37-27-21-34(22-28-37)42(4,5)6)35-23-15-30(16-24-35)29-40-38-13-9-7-11-31(38)17-18-32-12-8-10-14-39(32)40/h7-29H,1-6H3 |
| InChIKey | WNGJFQZSISVQAP-UHFFFAOYSA-N |
| XLogP | 11.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.80 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|