C32H36F3N5O6 — CID 22904908
3-[7-[6-(diaminomethylideneamino)hexyl]-1-(naphthalen-2-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22904908) has the molecular formula C32H36F3N5O6 and a molecular weight of 643.66 g/mol. Its IUPAC name is 3-[7-[6-(diaminomethylideneamino)hexyl]-1-(naphthalen-2-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[6-(diaminomethylideneamino)hexyl]-1-(naphthalen-2-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22904908 |
| Molecular Formula | C32H36F3N5O6 |
| Molecular Weight | 643.66 g/mol |
| Exact Mass | 643.26 |
| IUPAC Name | 3-[7-[6-(diaminomethylideneamino)hexyl]-1-(naphthalen-2-ylmethyl)-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCCCCCc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2Cc1ccc2ccccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H35N5O4.C2HF3O2/c31-30(32)33-15-6-2-1-3-7-21-11-13-26-25(18-21)29(39)34(16-14-28(37)38)20-27(36)35(26)19-22-10-12-23-8-4-5-9-24(23)17-22;3-2(4,5)1(6)7/h4-5,8-13,17-18H,1-3,6-7,14-16,19-20H2,(H,37,38)(H4,31,32,33);(H,6,7) |
| InChIKey | ILVGNGWBJVYZKV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.66 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|