C26H30F3N5O6 — CID 22904930
3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22904930) has the molecular formula C26H30F3N5O6 and a molecular weight of 565.55 g/mol. Its IUPAC name is 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22904930 |
| Molecular Formula | C26H30F3N5O6 |
| Molecular Weight | 565.55 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-1-phenyl-3H-1,4-benzodiazepin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | NC(N)=NCCCCCc1ccc2c(c1)C(=O)N(CCC(=O)O)CC(=O)N2c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H29N5O4.C2HF3O2/c25-24(26)27-13-6-2-3-7-17-10-11-20-19(15-17)23(33)28(14-12-22(31)32)16-21(30)29(20)18-8-4-1-5-9-18;3-2(4,5)1(6)7/h1,4-5,8-11,15H,2-3,6-7,12-14,16H2,(H,31,32)(H4,25,26,27);(H,6,7) |
| InChIKey | CBWCACUBITZIGZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|