C35H40F3N5O6 — CID 22905217
3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905217) has the molecular formula C35H40F3N5O6 and a molecular weight of 683.73 g/mol. Its IUPAC name is 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905217 |
| Molecular Formula | C35H40F3N5O6 |
| Molecular Weight | 683.73 g/mol |
| Exact Mass | 683.29 |
| IUPAC Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-2,5-dioxo-3-phenyl-1-propan-2-yl-3H-1,4-benzodiazepin-4-yl]-3-phenylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)N1C(=O)C(c2ccccc2)N(C(CC(=O)O)c2ccccc2)C(=O)c2cc(CCCCCN=C(N)N)ccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H39N5O4.C2HF3O2/c1-22(2)37-27-18-17-23(12-6-5-11-19-36-33(34)35)20-26(27)31(41)38(30(32(37)42)25-15-9-4-10-16-25)28(21-29(39)40)24-13-7-3-8-14-24;3-2(4,5)1(6)7/h3-4,7-10,13-18,20,22,28,30H,5-6,11-12,19,21H2,1-2H3,(H,39,40)(H4,34,35,36);(H,6,7) |
| InChIKey | FQYBDSQXTHYZAF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|