C29H35F3N6O8 — CID 22905407
3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-2-(phenylmethoxycarbonylamino)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22905407) has the molecular formula C29H35F3N6O8 and a molecular weight of 652.63 g/mol. Its IUPAC name is 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-2-(phenylmethoxycarbonylamino)propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-2-(phenylmethoxycarbonylamino)propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22905407 |
| Molecular Formula | C29H35F3N6O8 |
| Molecular Weight | 652.63 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3H-1,4-benzodiazepin-4-yl]-2-(phenylmethoxycarbonylamino)propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CN1C(=O)CN(CC(NC(=O)OCc2ccccc2)C(=O)O)C(=O)c2cc(CCCCCN=C(N)N)ccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H34N6O6.C2HF3O2/c1-32-22-12-11-18(8-6-3-7-13-30-26(28)29)14-20(22)24(35)33(16-23(32)34)15-21(25(36)37)31-27(38)39-17-19-9-4-2-5-10-19;3-2(4,5)1(6)7/h2,4-5,9-12,14,21H,3,6-8,13,15-17H2,1H3,(H,31,38)(H,36,37)(H4,28,29,30);(H,6,7) |
| InChIKey | FIPQYICXDGATEF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 217.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|