C22H23N5O6 — CID 22906981
1-benzyl-5-nitro-2-piperazin-1-ylbenzimidazole;(E)-but-2-enedioic acid (PubChem CID 22906981) has the molecular formula C22H23N5O6 and a molecular weight of 453.46 g/mol. Its IUPAC name is 1-benzyl-5-nitro-2-piperazin-1-ylbenzimidazole;(E)-but-2-enedioic acid.
| Compound Name | 1-benzyl-5-nitro-2-piperazin-1-ylbenzimidazole;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 22906981 |
| Molecular Formula | C22H23N5O6 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 1-benzyl-5-nitro-2-piperazin-1-ylbenzimidazole;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.O=[N+]([O-])c1ccc2c(c1)nc(N1CCNCC1)n2Cc1ccccc1 |
| InChI | InChI=1S/C18H19N5O2.C4H4O4/c24-23(25)15-6-7-17-16(12-15)20-18(21-10-8-19-9-11-21)22(17)13-14-4-2-1-3-5-14;5-3(6)1-2-4(7)8/h1-7,12,19H,8-11,13H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CQNQULDHCBEXLB-WLHGVMLRSA-N |
| XLogP | 2.11 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|