C32H37F3N2O5 — CID 22913426
[4-(3-ethoxy-1,1,1-trifluoropropan-2-yl)oxycarbonylphenyl] 4-(5-nonylpyrimidin-2-yl)benzoate (PubChem CID 22913426) has the molecular formula C32H37F3N2O5 and a molecular weight of 586.65 g/mol. Its IUPAC name is [4-(3-ethoxy-1,1,1-trifluoropropan-2-yl)oxycarbonylphenyl] 4-(5-nonylpyrimidin-2-yl)benzoate.
| Compound Name | [4-(3-ethoxy-1,1,1-trifluoropropan-2-yl)oxycarbonylphenyl] 4-(5-nonylpyrimidin-2-yl)benzoate |
|---|---|
| PubChem CID | 22913426 |
| Molecular Formula | C32H37F3N2O5 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | [4-(3-ethoxy-1,1,1-trifluoropropan-2-yl)oxycarbonylphenyl] 4-(5-nonylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc(C(=O)OC(COCC)C(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C32H37F3N2O5/c1-3-5-6-7-8-9-10-11-23-20-36-29(37-21-23)24-12-14-25(15-13-24)30(38)41-27-18-16-26(17-19-27)31(39)42-28(22-40-4-2)32(33,34)35/h12-21,28H,3-11,22H2,1-2H3 |
| InChIKey | LGITVILUOJFRJX-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|