C13H15F5N2O4 — CID 22922479
2-[2-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylic acid (PubChem CID 22922479) has the molecular formula C13H15F5N2O4 and a molecular weight of 358.26 g/mol. Its IUPAC name is 2-[2-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[2-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22922479 |
| Molecular Formula | C13H15F5N2O4 |
| Molecular Weight | 358.26 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-[2-(2,2,3,3,3-pentafluoropropanoyl)pyrrolidine-1-carbonyl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC1C(=O)N1CCCC1C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F5N2O4/c14-12(15,13(16,17)18)9(21)7-3-1-5-19(7)10(22)8-4-2-6-20(8)11(23)24/h7-8H,1-6H2,(H,23,24) |
| InChIKey | BTITYVKIJPCDGH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|