C14H12NO3- — CID 22933228
2-[5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate (PubChem CID 22933228) has the molecular formula C14H12NO3- and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-[5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate.
| Compound Name | 2-[5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 22933228 |
| Molecular Formula | C14H12NO3- |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-yl]acetate |
| SMILES | Cc1oc(/C=C/c2ccccc2)nc1CC(=O)[O-] |
| InChI | InChI=1S/C14H13NO3/c1-10-12(9-14(16)17)15-13(18-10)8-7-11-5-3-2-4-6-11/h2-8H,9H2,1H3,(H,16,17)/p-1/b8-7+ |
| InChIKey | JXWBMJHCIPVTFX-BQYQJAHWSA-M |
| XLogP | 1.45 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |