C9H12O3S3 — CID 22937550
[3,5-bis(sulfanylmethoxy)phenoxy]methanethiol (PubChem CID 22937550) has the molecular formula C9H12O3S3 and a molecular weight of 264.39 g/mol. Its IUPAC name is [3,5-bis(sulfanylmethoxy)phenoxy]methanethiol.
| Compound Name | [3,5-bis(sulfanylmethoxy)phenoxy]methanethiol |
|---|---|
| PubChem CID | 22937550 |
| Molecular Formula | C9H12O3S3 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | [3,5-bis(sulfanylmethoxy)phenoxy]methanethiol |
| SMILES | SCOc1cc(OCS)cc(OCS)c1 |
| InChI | InChI=1S/C9H12O3S3/c13-4-10-7-1-8(11-5-14)3-9(2-7)12-6-15/h1-3,13-15H,4-6H2 |
| InChIKey | CYVANFZTHHKUSB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|