C23H33N4O6S+ — CID 22941668
[(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-hydroxy-(4-methoxyphenyl)sulfonyl-[4-[methyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]azanium (PubChem CID 22941668) has the molecular formula C23H33N4O6S+ and a molecular weight of 493.61 g/mol. Its IUPAC name is [(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-hydroxy-(4-methoxyphenyl)sulfonyl-[4-[methyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]azanium.
| Compound Name | [(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-hydroxy-(4-methoxyphenyl)sulfonyl-[4-[methyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]azanium |
|---|---|
| PubChem CID | 22941668 |
| Molecular Formula | C23H33N4O6S+ |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | [(2R)-1-amino-3-methyl-1-oxobutan-2-yl]-hydroxy-(4-methoxyphenyl)sulfonyl-[4-[methyl(pyridin-3-ylmethyl)amino]-4-oxobutyl]azanium |
| SMILES | COc1ccc(S(=O)(=O)[N+](O)(CCCC(=O)N(C)Cc2cccnc2)[C@@H](C(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H32N4O6S/c1-17(2)22(23(24)29)27(30,34(31,32)20-11-9-19(33-4)10-12-20)14-6-8-21(28)26(3)16-18-7-5-13-25-15-18/h5,7,9-13,15,17,22,30H,6,8,14,16H2,1-4H3,(H-,24,29)/p+1/t22-,27?/m1/s1 |
| InChIKey | CXPMBOIVUZVNKJ-XVPAFAEQSA-O |
| XLogP | 1.93 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|