C8H13N4+ — CID 22944533
1-ethyl-3,6-dimethyl-7H-pyrazolo[5,1-c][1,2,4]triazol-4-ium (PubChem CID 22944533) has the molecular formula C8H13N4+ and a molecular weight of 165.22 g/mol. Its IUPAC name is 1-ethyl-3,6-dimethyl-7H-pyrazolo[5,1-c][1,2,4]triazol-4-ium.
| Compound Name | 1-ethyl-3,6-dimethyl-7H-pyrazolo[5,1-c][1,2,4]triazol-4-ium |
|---|---|
| PubChem CID | 22944533 |
| Molecular Formula | C8H13N4+ |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | 1-ethyl-3,6-dimethyl-7H-pyrazolo[5,1-c][1,2,4]triazol-4-ium |
| SMILES | CCn1nc(C)[n+]2c1CC(C)=N2 |
| InChI | InChI=1S/C8H13N4/c1-4-11-8-5-6(2)9-12(8)7(3)10-11/h4-5H2,1-3H3/q+1 |
| InChIKey | RUVSVUPKGONRCJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|