C16H21NO — CID 22946268
2-ethyl-1-[3-(methoxymethyl)-2,4-dimethylphenyl]pyrrole (PubChem CID 22946268) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-ethyl-1-[3-(methoxymethyl)-2,4-dimethylphenyl]pyrrole.
| Compound Name | 2-ethyl-1-[3-(methoxymethyl)-2,4-dimethylphenyl]pyrrole |
|---|---|
| PubChem CID | 22946268 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-ethyl-1-[3-(methoxymethyl)-2,4-dimethylphenyl]pyrrole |
| SMILES | CCc1cccn1-c1ccc(C)c(COC)c1C |
| InChI | InChI=1S/C16H21NO/c1-5-14-7-6-10-17(14)16-9-8-12(2)15(11-18-4)13(16)3/h6-10H,5,11H2,1-4H3 |
| InChIKey | ISILQIKUGBJYDJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |