C20H28N6O5S — CID 22949227
N-[2-[carbamimidoyl(ethyl)amino]oxyethyl]-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide (PubChem CID 22949227) has the molecular formula C20H28N6O5S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[2-[carbamimidoyl(ethyl)amino]oxyethyl]-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide.
| Compound Name | N-[2-[carbamimidoyl(ethyl)amino]oxyethyl]-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 22949227 |
| Molecular Formula | C20H28N6O5S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[2-[carbamimidoyl(ethyl)amino]oxyethyl]-2-[6-methyl-3-[(3-methylphenyl)sulfonylamino]-2-oxo-1-pyridinyl]acetamide |
| SMILES | [H]/N=C(\N)N(CC)OCCNC(=O)Cn1c(C)ccc(NS(=O)(=O)c2cccc(C)c2)c1=O |
| InChI | InChI=1S/C20H28N6O5S/c1-4-26(20(21)22)31-11-10-23-18(27)13-25-15(3)8-9-17(19(25)28)24-32(29,30)16-7-5-6-14(2)12-16/h5-9,12,24H,4,10-11,13H2,1-3H3,(H3,21,22)(H,23,27) |
| InChIKey | HXADUCKHBYMBKV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 159.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|